C19H31NO3S — CID 43845535
1-(4-heptoxy-3-methylphenyl)sulfonylpiperidine (PubChem CID 43845535) has the molecular formula C19H31NO3S and a molecular weight of 353.53 g/mol. Its IUPAC name is 1-(4-heptoxy-3-methylphenyl)sulfonylpiperidine.
| Compound Name | 1-(4-heptoxy-3-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 43845535 |
| Molecular Formula | C19H31NO3S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 1-(4-heptoxy-3-methylphenyl)sulfonylpiperidine |
| SMILES | CCCCCCCOc1ccc(S(=O)(=O)N2CCCCC2)cc1C |
| InChI | InChI=1S/C19H31NO3S/c1-3-4-5-6-10-15-23-19-12-11-18(16-17(19)2)24(21,22)20-13-8-7-9-14-20/h11-12,16H,3-10,13-15H2,1-2H3 |
| InChIKey | XAXUIROPOYPJBI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|