C20H27NO6S2 — CID 90590728
4-(furan-2-ylmethylsulfonyl)-1-(3-methyl-4-propoxyphenyl)sulfonylpiperidine (PubChem CID 90590728) has the molecular formula C20H27NO6S2 and a molecular weight of 441.57 g/mol. Its IUPAC name is 4-(furan-2-ylmethylsulfonyl)-1-(3-methyl-4-propoxyphenyl)sulfonylpiperidine.
| Compound Name | 4-(furan-2-ylmethylsulfonyl)-1-(3-methyl-4-propoxyphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 90590728 |
| Molecular Formula | C20H27NO6S2 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 4-(furan-2-ylmethylsulfonyl)-1-(3-methyl-4-propoxyphenyl)sulfonylpiperidine |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCC(S(=O)(=O)Cc3ccco3)CC2)cc1C |
| InChI | InChI=1S/C20H27NO6S2/c1-3-12-27-20-7-6-19(14-16(20)2)29(24,25)21-10-8-18(9-11-21)28(22,23)15-17-5-4-13-26-17/h4-7,13-14,18H,3,8-12,15H2,1-2H3 |
| InChIKey | ZNTSNXNRKQNEPN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |