C21H30N2O4S — CID 16888241
N-[[1-(furan-2-ylmethyl)piperidin-4-yl]methyl]-3-methyl-4-propoxybenzenesulfonamide (PubChem CID 16888241) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is N-[[1-(furan-2-ylmethyl)piperidin-4-yl]methyl]-3-methyl-4-propoxybenzenesulfonamide.
| Compound Name | N-[[1-(furan-2-ylmethyl)piperidin-4-yl]methyl]-3-methyl-4-propoxybenzenesulfonamide |
|---|---|
| PubChem CID | 16888241 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[[1-(furan-2-ylmethyl)piperidin-4-yl]methyl]-3-methyl-4-propoxybenzenesulfonamide |
| SMILES | CCCOc1ccc(S(=O)(=O)NCC2CCN(Cc3ccco3)CC2)cc1C |
| InChI | InChI=1S/C21H30N2O4S/c1-3-12-27-21-7-6-20(14-17(21)2)28(24,25)22-15-18-8-10-23(11-9-18)16-19-5-4-13-26-19/h4-7,13-14,18,22H,3,8-12,15-16H2,1-2H3 |
| InChIKey | CTJPFNGMNXUGKS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |