C17H21BrN2O3S — CID 16888184
2-bromo-N-[[1-(furan-2-ylmethyl)piperidin-4-yl]methyl]benzenesulfonamide (PubChem CID 16888184) has the molecular formula C17H21BrN2O3S and a molecular weight of 413.34 g/mol. Its IUPAC name is 2-bromo-N-[[1-(furan-2-ylmethyl)piperidin-4-yl]methyl]benzenesulfonamide.
| Compound Name | 2-bromo-N-[[1-(furan-2-ylmethyl)piperidin-4-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16888184 |
| Molecular Formula | C17H21BrN2O3S |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 2-bromo-N-[[1-(furan-2-ylmethyl)piperidin-4-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCN(Cc2ccco2)CC1)c1ccccc1Br |
| InChI | InChI=1S/C17H21BrN2O3S/c18-16-5-1-2-6-17(16)24(21,22)19-12-14-7-9-20(10-8-14)13-15-4-3-11-23-15/h1-6,11,14,19H,7-10,12-13H2 |
| InChIKey | SYLQEDDUBYWQDI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |