C18H23NO5S2 — CID 90590683
1-(2,5-dimethylphenyl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine (PubChem CID 90590683) has the molecular formula C18H23NO5S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine |
|---|---|
| PubChem CID | 90590683 |
| Molecular Formula | C18H23NO5S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC(S(=O)(=O)Cc3ccco3)CC2)c1 |
| InChI | InChI=1S/C18H23NO5S2/c1-14-5-6-15(2)18(12-14)26(22,23)19-9-7-17(8-10-19)25(20,21)13-16-4-3-11-24-16/h3-6,11-12,17H,7-10,13H2,1-2H3 |
| InChIKey | GSFFUHBHDMTEBS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |