C14H16ClNO5S3 — CID 90590695
1-(5-chlorothiophen-2-yl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine (PubChem CID 90590695) has the molecular formula C14H16ClNO5S3 and a molecular weight of 409.94 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine |
|---|---|
| PubChem CID | 90590695 |
| Molecular Formula | C14H16ClNO5S3 |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine |
| SMILES | O=S(=O)(Cc1ccco1)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C14H16ClNO5S3/c15-13-3-4-14(22-13)24(19,20)16-7-5-12(6-8-16)23(17,18)10-11-2-1-9-21-11/h1-4,9,12H,5-8,10H2 |
| InChIKey | HMXFYAHFEQHBPG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |