C14H21NO4S — CID 90590612
1-[4-(furan-2-ylmethylsulfonyl)piperidin-1-yl]-2-methylpropan-1-one (PubChem CID 90590612) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is 1-[4-(furan-2-ylmethylsulfonyl)piperidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-(furan-2-ylmethylsulfonyl)piperidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 90590612 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-[4-(furan-2-ylmethylsulfonyl)piperidin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCC(S(=O)(=O)Cc2ccco2)CC1 |
| InChI | InChI=1S/C14H21NO4S/c1-11(2)14(16)15-7-5-13(6-8-15)20(17,18)10-12-4-3-9-19-12/h3-4,9,11,13H,5-8,10H2,1-2H3 |
| InChIKey | BFPJVYQLEZAGGZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |