C21H27NO4S — CID 90590567
1-[4-(furan-2-ylmethylsulfonyl)piperidin-1-yl]-5-phenylpentan-1-one (PubChem CID 90590567) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-[4-(furan-2-ylmethylsulfonyl)piperidin-1-yl]-5-phenylpentan-1-one.
| Compound Name | 1-[4-(furan-2-ylmethylsulfonyl)piperidin-1-yl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 90590567 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[4-(furan-2-ylmethylsulfonyl)piperidin-1-yl]-5-phenylpentan-1-one |
| SMILES | O=C(CCCCc1ccccc1)N1CCC(S(=O)(=O)Cc2ccco2)CC1 |
| InChI | InChI=1S/C21H27NO4S/c23-21(11-5-4-9-18-7-2-1-3-8-18)22-14-12-20(13-15-22)27(24,25)17-19-10-6-16-26-19/h1-3,6-8,10,16,20H,4-5,9,11-15,17H2 |
| InChIKey | WVEPZQXUHPWUAS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|