C21H23N3O5S — CID 90590574
3-[3-[4-(furan-2-ylmethylsulfonyl)piperidin-1-yl]-3-oxopropyl]quinazolin-4-one (PubChem CID 90590574) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 3-[3-[4-(furan-2-ylmethylsulfonyl)piperidin-1-yl]-3-oxopropyl]quinazolin-4-one.
| Compound Name | 3-[3-[4-(furan-2-ylmethylsulfonyl)piperidin-1-yl]-3-oxopropyl]quinazolin-4-one |
|---|---|
| PubChem CID | 90590574 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 3-[3-[4-(furan-2-ylmethylsulfonyl)piperidin-1-yl]-3-oxopropyl]quinazolin-4-one |
| SMILES | O=C(CCn1cnc2ccccc2c1=O)N1CCC(S(=O)(=O)Cc2ccco2)CC1 |
| InChI | InChI=1S/C21H23N3O5S/c25-20(9-12-24-15-22-19-6-2-1-5-18(19)21(24)26)23-10-7-17(8-11-23)30(27,28)14-16-4-3-13-29-16/h1-6,13,15,17H,7-12,14H2 |
| InChIKey | DSJHXEGZVNDTEM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 102.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |