C13H21NO5S2 — CID 90590673
4-(furan-2-ylmethylsulfonyl)-1-propan-2-ylsulfonylpiperidine (PubChem CID 90590673) has the molecular formula C13H21NO5S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-(furan-2-ylmethylsulfonyl)-1-propan-2-ylsulfonylpiperidine.
| Compound Name | 4-(furan-2-ylmethylsulfonyl)-1-propan-2-ylsulfonylpiperidine |
|---|---|
| PubChem CID | 90590673 |
| Molecular Formula | C13H21NO5S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-(furan-2-ylmethylsulfonyl)-1-propan-2-ylsulfonylpiperidine |
| SMILES | CC(C)S(=O)(=O)N1CCC(S(=O)(=O)Cc2ccco2)CC1 |
| InChI | InChI=1S/C13H21NO5S2/c1-11(2)21(17,18)14-7-5-13(6-8-14)20(15,16)10-12-4-3-9-19-12/h3-4,9,11,13H,5-8,10H2,1-2H3 |
| InChIKey | KQAFBXCTDXTYPD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |