C20H27NO5S2 — CID 90590714
1-(4-tert-butylphenyl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine (PubChem CID 90590714) has the molecular formula C20H27NO5S2 and a molecular weight of 425.57 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine |
|---|---|
| PubChem CID | 90590714 |
| Molecular Formula | C20H27NO5S2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCC(S(=O)(=O)Cc3ccco3)CC2)cc1 |
| InChI | InChI=1S/C20H27NO5S2/c1-20(2,3)16-6-8-19(9-7-16)28(24,25)21-12-10-18(11-13-21)27(22,23)15-17-5-4-14-26-17/h4-9,14,18H,10-13,15H2,1-3H3 |
| InChIKey | WNVYNJBPICHLKY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |