C19H25NO3S2 — CID 90632505
4-(4-tert-butylphenyl)sulfonyl-7-(furan-2-yl)-1,4-thiazepane (PubChem CID 90632505) has the molecular formula C19H25NO3S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)sulfonyl-7-(furan-2-yl)-1,4-thiazepane.
| Compound Name | 4-(4-tert-butylphenyl)sulfonyl-7-(furan-2-yl)-1,4-thiazepane |
|---|---|
| PubChem CID | 90632505 |
| Molecular Formula | C19H25NO3S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 4-(4-tert-butylphenyl)sulfonyl-7-(furan-2-yl)-1,4-thiazepane |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCSC(c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C19H25NO3S2/c1-19(2,3)15-6-8-16(9-7-15)25(21,22)20-11-10-18(24-14-12-20)17-5-4-13-23-17/h4-9,13,18H,10-12,14H2,1-3H3 |
| InChIKey | VSVWGNCFJBSWRG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |