C17H28N2O2S — CID 119974952
1-[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]ethanamine (PubChem CID 119974952) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 1-[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]ethanamine.
| Compound Name | 1-[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 119974952 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 1-[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]ethanamine |
| SMILES | CC(N)C1CCN(S(=O)(=O)c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C17H28N2O2S/c1-13(18)14-9-11-19(12-10-14)22(20,21)16-7-5-15(6-8-16)17(2,3)4/h5-8,13-14H,9-12,18H2,1-4H3 |
| InChIKey | ZOPRMMMPYGSFAR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |