C14H22ClFN2O4S2 — CID 119974631
1-[1-(3-fluoro-4-methylsulfonylphenyl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride (PubChem CID 119974631) has the molecular formula C14H22ClFN2O4S2 and a molecular weight of 400.93 g/mol. Its IUPAC name is 1-[1-(3-fluoro-4-methylsulfonylphenyl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-(3-fluoro-4-methylsulfonylphenyl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119974631 |
| Molecular Formula | C14H22ClFN2O4S2 |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 1-[1-(3-fluoro-4-methylsulfonylphenyl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride |
| SMILES | CC(N)C1CCN(S(=O)(=O)c2ccc(S(C)(=O)=O)c(F)c2)CC1.Cl |
| InChI | InChI=1S/C14H21FN2O4S2.ClH/c1-10(16)11-5-7-17(8-6-11)23(20,21)12-3-4-14(13(15)9-12)22(2,18)19;/h3-4,9-11H,5-8,16H2,1-2H3;1H |
| InChIKey | ACVRTYMSHWEKOM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |