C14H22FN3O4S2 — CID 119984443
N-[4-[3-(1-aminoethyl)piperidin-1-yl]sulfonyl-2-fluorophenyl]methanesulfonamide (PubChem CID 119984443) has the molecular formula C14H22FN3O4S2 and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[4-[3-(1-aminoethyl)piperidin-1-yl]sulfonyl-2-fluorophenyl]methanesulfonamide.
| Compound Name | N-[4-[3-(1-aminoethyl)piperidin-1-yl]sulfonyl-2-fluorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 119984443 |
| Molecular Formula | C14H22FN3O4S2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[4-[3-(1-aminoethyl)piperidin-1-yl]sulfonyl-2-fluorophenyl]methanesulfonamide |
| SMILES | CC(N)C1CCCN(S(=O)(=O)c2ccc(NS(C)(=O)=O)c(F)c2)C1 |
| InChI | InChI=1S/C14H22FN3O4S2/c1-10(16)11-4-3-7-18(9-11)24(21,22)12-5-6-14(13(15)8-12)17-23(2,19)20/h5-6,8,10-11,17H,3-4,7,9,16H2,1-2H3 |
| InChIKey | WIJZOVFEMPRURL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |