C14H18FN3O2S — CID 129369876
5-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]sulfonyl-2-fluorobenzonitrile (PubChem CID 129369876) has the molecular formula C14H18FN3O2S and a molecular weight of 311.38 g/mol. Its IUPAC name is 5-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]sulfonyl-2-fluorobenzonitrile.
| Compound Name | 5-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]sulfonyl-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 129369876 |
| Molecular Formula | C14H18FN3O2S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 5-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]sulfonyl-2-fluorobenzonitrile |
| SMILES | C[C@@H](N)[C@@H]1CCCN(S(=O)(=O)c2ccc(F)c(C#N)c2)C1 |
| InChI | InChI=1S/C14H18FN3O2S/c1-10(17)11-3-2-6-18(9-11)21(19,20)13-4-5-14(15)12(7-13)8-16/h4-5,7,10-11H,2-3,6,9,17H2,1H3/t10-,11-/m1/s1 |
| InChIKey | ZEJUWAJBGVQKFZ-GHMZBOCLSA-N |
| XLogP | 1.45 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |