C14H19ClFN3O2S — CID 119965338
5-[2-(1-aminoethyl)piperidin-1-yl]sulfonyl-2-fluorobenzonitrile;hydrochloride (PubChem CID 119965338) has the molecular formula C14H19ClFN3O2S and a molecular weight of 347.84 g/mol. Its IUPAC name is 5-[2-(1-aminoethyl)piperidin-1-yl]sulfonyl-2-fluorobenzonitrile;hydrochloride.
| Compound Name | 5-[2-(1-aminoethyl)piperidin-1-yl]sulfonyl-2-fluorobenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 119965338 |
| Molecular Formula | C14H19ClFN3O2S |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 5-[2-(1-aminoethyl)piperidin-1-yl]sulfonyl-2-fluorobenzonitrile;hydrochloride |
| SMILES | CC(N)C1CCCCN1S(=O)(=O)c1ccc(F)c(C#N)c1.Cl |
| InChI | InChI=1S/C14H18FN3O2S.ClH/c1-10(17)14-4-2-3-7-18(14)21(19,20)12-5-6-13(15)11(8-12)9-16;/h5-6,8,10,14H,2-4,7,17H2,1H3;1H |
| InChIKey | GSTZPNIIIKUKGF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |