C13H19BrClFN2O2S — CID 119965451
1-[1-(4-bromo-3-fluorophenyl)sulfonylpiperidin-2-yl]ethanamine;hydrochloride (PubChem CID 119965451) has the molecular formula C13H19BrClFN2O2S and a molecular weight of 401.73 g/mol. Its IUPAC name is 1-[1-(4-bromo-3-fluorophenyl)sulfonylpiperidin-2-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-(4-bromo-3-fluorophenyl)sulfonylpiperidin-2-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119965451 |
| Molecular Formula | C13H19BrClFN2O2S |
| Molecular Weight | 401.73 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 1-[1-(4-bromo-3-fluorophenyl)sulfonylpiperidin-2-yl]ethanamine;hydrochloride |
| SMILES | CC(N)C1CCCCN1S(=O)(=O)c1ccc(Br)c(F)c1.Cl |
| InChI | InChI=1S/C13H18BrFN2O2S.ClH/c1-9(16)13-4-2-3-7-17(13)20(18,19)10-5-6-11(14)12(15)8-10;/h5-6,8-9,13H,2-4,7,16H2,1H3;1H |
| InChIKey | ZQXJKUPKFYXNFS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |