C13H21N3O4S2 — CID 125118493
3-[(2S)-2-[(1S)-1-aminoethyl]piperidin-1-yl]sulfonylbenzenesulfonamide (PubChem CID 125118493) has the molecular formula C13H21N3O4S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-[(2S)-2-[(1S)-1-aminoethyl]piperidin-1-yl]sulfonylbenzenesulfonamide.
| Compound Name | 3-[(2S)-2-[(1S)-1-aminoethyl]piperidin-1-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 125118493 |
| Molecular Formula | C13H21N3O4S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-[(2S)-2-[(1S)-1-aminoethyl]piperidin-1-yl]sulfonylbenzenesulfonamide |
| SMILES | C[C@H](N)[C@@H]1CCCCN1S(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H21N3O4S2/c1-10(14)13-7-2-3-8-16(13)22(19,20)12-6-4-5-11(9-12)21(15,17)18/h4-6,9-10,13H,2-3,7-8,14H2,1H3,(H2,15,17,18)/t10-,13-/m0/s1 |
| InChIKey | LHTDUKVPGKPBQR-GWCFXTLKSA-N |
| XLogP | 0.22 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |