C14H22N2O4S2 — CID 124691045
(1S)-1-[(2S)-1-(2-methylsulfonylphenyl)sulfonylpiperidin-2-yl]ethanamine (PubChem CID 124691045) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is (1S)-1-[(2S)-1-(2-methylsulfonylphenyl)sulfonylpiperidin-2-yl]ethanamine.
| Compound Name | (1S)-1-[(2S)-1-(2-methylsulfonylphenyl)sulfonylpiperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 124691045 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (1S)-1-[(2S)-1-(2-methylsulfonylphenyl)sulfonylpiperidin-2-yl]ethanamine |
| SMILES | C[C@H](N)[C@@H]1CCCCN1S(=O)(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C14H22N2O4S2/c1-11(15)12-7-5-6-10-16(12)22(19,20)14-9-4-3-8-13(14)21(2,17)18/h3-4,8-9,11-12H,5-7,10,15H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | CVSDUCDNIWTYPC-RYUDHWBXSA-N |
| XLogP | 0.98 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |