C13H18ClFN2O2S — CID 124570360
(1S)-1-[(2S)-1-(2-chloro-5-fluorophenyl)sulfonylpiperidin-2-yl]ethanamine (PubChem CID 124570360) has the molecular formula C13H18ClFN2O2S and a molecular weight of 320.82 g/mol. Its IUPAC name is (1S)-1-[(2S)-1-(2-chloro-5-fluorophenyl)sulfonylpiperidin-2-yl]ethanamine.
| Compound Name | (1S)-1-[(2S)-1-(2-chloro-5-fluorophenyl)sulfonylpiperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 124570360 |
| Molecular Formula | C13H18ClFN2O2S |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (1S)-1-[(2S)-1-(2-chloro-5-fluorophenyl)sulfonylpiperidin-2-yl]ethanamine |
| SMILES | C[C@H](N)[C@@H]1CCCCN1S(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C13H18ClFN2O2S/c1-9(16)12-4-2-3-7-17(12)20(18,19)13-8-10(15)5-6-11(13)14/h5-6,8-9,12H,2-4,7,16H2,1H3/t9-,12-/m0/s1 |
| InChIKey | BHDKOQMADQEVBE-CABZTGNLSA-N |
| XLogP | 2.37 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |