C12H13ClFNO3S — CID 105400762
1-(2-chloro-5-fluorophenyl)sulfonylpiperidine-2-carbaldehyde (PubChem CID 105400762) has the molecular formula C12H13ClFNO3S and a molecular weight of 305.76 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)sulfonylpiperidine-2-carbaldehyde.
| Compound Name | 1-(2-chloro-5-fluorophenyl)sulfonylpiperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 105400762 |
| Molecular Formula | C12H13ClFNO3S |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)sulfonylpiperidine-2-carbaldehyde |
| SMILES | O=CC1CCCCN1S(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C12H13ClFNO3S/c13-11-5-4-9(14)7-12(11)19(17,18)15-6-2-1-3-10(15)8-16/h4-5,7-8,10H,1-3,6H2 |
| InChIKey | FCOBRAYPVDHJNG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|