C11H10ClFN2O3S — CID 105400275
1-(2-chloro-5-fluorophenyl)sulfonyl-2-isocyanatopyrrolidine (PubChem CID 105400275) has the molecular formula C11H10ClFN2O3S and a molecular weight of 304.73 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)sulfonyl-2-isocyanatopyrrolidine.
| Compound Name | 1-(2-chloro-5-fluorophenyl)sulfonyl-2-isocyanatopyrrolidine |
|---|---|
| PubChem CID | 105400275 |
| Molecular Formula | C11H10ClFN2O3S |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)sulfonyl-2-isocyanatopyrrolidine |
| SMILES | O=C=NC1CCCN1S(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C11H10ClFN2O3S/c12-9-4-3-8(13)6-10(9)19(17,18)15-5-1-2-11(15)14-7-16/h3-4,6,11H,1-2,5H2 |
| InChIKey | MVWZSVUYQPRZJF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|