C14H17FN2O3S — CID 107327702
1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2-isocyanatopiperidine (PubChem CID 107327702) has the molecular formula C14H17FN2O3S and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2-isocyanatopiperidine.
| Compound Name | 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2-isocyanatopiperidine |
|---|---|
| PubChem CID | 107327702 |
| Molecular Formula | C14H17FN2O3S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2-isocyanatopiperidine |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)N1CCCCC1N=C=O |
| InChI | InChI=1S/C14H17FN2O3S/c1-10-7-12(15)8-11(2)14(10)21(19,20)17-6-4-3-5-13(17)16-9-18/h7-8,13H,3-6H2,1-2H3 |
| InChIKey | JWLYVJXYSOALOE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|