C13H13N3O3S — CID 106920447
4-(2-isocyanatopyrrolidin-1-yl)sulfonyl-2-methylbenzonitrile (PubChem CID 106920447) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 4-(2-isocyanatopyrrolidin-1-yl)sulfonyl-2-methylbenzonitrile.
| Compound Name | 4-(2-isocyanatopyrrolidin-1-yl)sulfonyl-2-methylbenzonitrile |
|---|---|
| PubChem CID | 106920447 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-(2-isocyanatopyrrolidin-1-yl)sulfonyl-2-methylbenzonitrile |
| SMILES | Cc1cc(S(=O)(=O)N2CCCC2N=C=O)ccc1C#N |
| InChI | InChI=1S/C13H13N3O3S/c1-10-7-12(5-4-11(10)8-14)20(18,19)16-6-2-3-13(16)15-9-17/h4-5,7,13H,2-3,6H2,1H3 |
| InChIKey | QDBZTKFDYSHSJW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 90.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|