C14H16N2O4S — CID 106832984
methyl 1-(4-cyano-3-methylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 106832984) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is methyl 1-(4-cyano-3-methylphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(4-cyano-3-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 106832984 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | methyl 1-(4-cyano-3-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1S(=O)(=O)c1ccc(C#N)c(C)c1 |
| InChI | InChI=1S/C14H16N2O4S/c1-10-8-12(6-5-11(10)9-15)21(18,19)16-7-3-4-13(16)14(17)20-2/h5-6,8,13H,3-4,7H2,1-2H3 |
| InChIKey | XPWJSZNDEMYKLK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |