C12H14FNO4S — CID 43409871
methyl 1-(3-fluorophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 43409871) has the molecular formula C12H14FNO4S and a molecular weight of 287.31 g/mol. Its IUPAC name is methyl 1-(3-fluorophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(3-fluorophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 43409871 |
| Molecular Formula | C12H14FNO4S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | methyl 1-(3-fluorophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C12H14FNO4S/c1-18-12(15)11-6-3-7-14(11)19(16,17)10-5-2-4-9(13)8-10/h2,4-5,8,11H,3,6-7H2,1H3 |
| InChIKey | FUBWNGPOHISKLR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |