C14H17NO5S — CID 3866930
methyl 1-(4-acetylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 3866930) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is methyl 1-(4-acetylphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(4-acetylphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 3866930 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | methyl 1-(4-acetylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1S(=O)(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C14H17NO5S/c1-10(16)11-5-7-12(8-6-11)21(18,19)15-9-3-4-13(15)14(17)20-2/h5-8,13H,3-4,9H2,1-2H3 |
| InChIKey | ZYBICGRKCJMBCL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |