C17H21NO6S — CID 42978293
2-oxopropyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 42978293) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-oxopropyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | 2-oxopropyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 42978293 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-oxopropyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CC(=O)COC(=O)C1CCCCN1S(=O)(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C17H21NO6S/c1-12(19)11-24-17(21)16-5-3-4-10-18(16)25(22,23)15-8-6-14(7-9-15)13(2)20/h6-9,16H,3-5,10-11H2,1-2H3 |
| InChIKey | SBHBLEDGMBRXQP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |