C21H22N2O7S — CID 42990335
(4-nitrophenyl)methyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 42990335) has the molecular formula C21H22N2O7S and a molecular weight of 446.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 42990335 |
| Molecular Formula | C21H22N2O7S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (4-nitrophenyl)methyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCCCC2C(=O)OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H22N2O7S/c1-15(24)17-7-11-19(12-8-17)31(28,29)22-13-3-2-4-20(22)21(25)30-14-16-5-9-18(10-6-16)23(26)27/h5-12,20H,2-4,13-14H2,1H3 |
| InChIKey | JPQDBQVVVOYHFL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|