C18H17ClN2O6S — CID 1077245
(4-nitrophenyl)methyl (2S)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 1077245) has the molecular formula C18H17ClN2O6S and a molecular weight of 424.86 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 1077245 |
| Molecular Formula | C18H17ClN2O6S |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | (4-nitrophenyl)methyl (2S)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)[C@@H]1CCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN2O6S/c19-14-5-9-16(10-6-14)28(25,26)20-11-1-2-17(20)18(22)27-12-13-3-7-15(8-4-13)21(23)24/h3-10,17H,1-2,11-12H2/t17-/m0/s1 |
| InChIKey | LMMOOVNOBVJGDU-KRWDZBQOSA-N |
| XLogP | 3.14 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|