C19H20ClNO4S — CID 18281212
(4-chlorophenyl)methyl 1-(benzenesulfonyl)piperidine-2-carboxylate (PubChem CID 18281212) has the molecular formula C19H20ClNO4S and a molecular weight of 393.89 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 1-(benzenesulfonyl)piperidine-2-carboxylate.
| Compound Name | (4-chlorophenyl)methyl 1-(benzenesulfonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 18281212 |
| Molecular Formula | C19H20ClNO4S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (4-chlorophenyl)methyl 1-(benzenesulfonyl)piperidine-2-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)cc1)C1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20ClNO4S/c20-16-11-9-15(10-12-16)14-25-19(22)18-8-4-5-13-21(18)26(23,24)17-6-2-1-3-7-17/h1-3,6-7,9-12,18H,4-5,8,13-14H2 |
| InChIKey | SDIIRDSDSSQSLN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |