C21H22ClNO5S — CID 42986824
(3-chlorophenyl)methyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 42986824) has the molecular formula C21H22ClNO5S and a molecular weight of 435.93 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | (3-chlorophenyl)methyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 42986824 |
| Molecular Formula | C21H22ClNO5S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | (3-chlorophenyl)methyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCCCC2C(=O)OCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H22ClNO5S/c1-15(24)17-8-10-19(11-9-17)29(26,27)23-12-3-2-7-20(23)21(25)28-14-16-5-4-6-18(22)13-16/h4-6,8-11,13,20H,2-3,7,12,14H2,1H3 |
| InChIKey | KUFIPIMEVYLMKY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |