C25H26N2O7S — CID 55373236
3-(1,3-dioxoisoindol-2-yl)propyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 55373236) has the molecular formula C25H26N2O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 55373236 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 1-(4-acetylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCCCC2C(=O)OCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H26N2O7S/c1-17(28)18-10-12-19(13-11-18)35(32,33)27-15-5-4-9-22(27)25(31)34-16-6-14-26-23(29)20-7-2-3-8-21(20)24(26)30/h2-3,7-8,10-13,22H,4-6,9,14-16H2,1H3 |
| InChIKey | PQVNMSOLQZLWEA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|