C18H22N2O6S — CID 27138899
2-(1,3-dioxoisoindol-2-yl)ethyl (2R)-1-propylsulfonylpyrrolidine-2-carboxylate (PubChem CID 27138899) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl (2R)-1-propylsulfonylpyrrolidine-2-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (2R)-1-propylsulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 27138899 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (2R)-1-propylsulfonylpyrrolidine-2-carboxylate |
| SMILES | CCCS(=O)(=O)N1CCC[C@@H]1C(=O)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H22N2O6S/c1-2-12-27(24,25)20-9-5-8-15(20)18(23)26-11-10-19-16(21)13-6-3-4-7-14(13)17(19)22/h3-4,6-7,15H,2,5,8-12H2,1H3/t15-/m1/s1 |
| InChIKey | RWJXTGBCYQPKJK-OAHLLOKOSA-N |
| XLogP | 1.03 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|