C20H18N2O5S — CID 7532410
2-(1,3-dioxoisoindol-2-yl)ethyl (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 7532410) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 7532410 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)[C@@H]1CCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C20H18N2O5S/c23-17-13-5-1-2-6-14(13)18(24)22(17)10-11-27-20(26)15-7-3-9-21(15)19(25)16-8-4-12-28-16/h1-2,4-6,8,12,15H,3,7,9-11H2/t15-/m0/s1 |
| InChIKey | SFRPKFCBJCWVPE-HNNXBMFYSA-N |
| XLogP | 2.19 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|