C13H17NO3S — CID 60724197
ethyl 1-(thiophene-2-carbonyl)piperidine-2-carboxylate (PubChem CID 60724197) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is ethyl 1-(thiophene-2-carbonyl)piperidine-2-carboxylate.
| Compound Name | ethyl 1-(thiophene-2-carbonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 60724197 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | ethyl 1-(thiophene-2-carbonyl)piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C13H17NO3S/c1-2-17-13(16)10-6-3-4-8-14(10)12(15)11-7-5-9-18-11/h5,7,9-10H,2-4,6,8H2,1H3 |
| InChIKey | QXSHUQUWKKGKOG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |