C18H16ClNO4S — CID 2368756
[2-(4-chlorophenyl)-2-oxoethyl] (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 2368756) has the molecular formula C18H16ClNO4S and a molecular weight of 377.85 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 2368756 |
| Molecular Formula | C18H16ClNO4S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CCCN1C(=O)c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClNO4S/c19-13-7-5-12(6-8-13)15(21)11-24-18(23)14-3-1-9-20(14)17(22)16-4-2-10-25-16/h2,4-8,10,14H,1,3,9,11H2/t14-/m0/s1 |
| InChIKey | JLOUMLHFKXDJDW-AWEZNQCLSA-N |
| XLogP | 3.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |