C16H20N2O5S — CID 55315660
(2-morpholin-4-yl-2-oxoethyl) 1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 55315660) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55315660 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCOCC1)C1CCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C16H20N2O5S/c19-14(17-6-8-22-9-7-17)11-23-16(21)12-3-1-5-18(12)15(20)13-4-2-10-24-13/h2,4,10,12H,1,3,5-9,11H2 |
| InChIKey | BOZWXJJBOKNUAU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |