C18H15N3O4S — CID 7996654
4-amino-2-[(2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbonyl]isoindole-1,3-dione (PubChem CID 7996654) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is 4-amino-2-[(2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbonyl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[(2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 7996654 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 4-amino-2-[(2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbonyl]isoindole-1,3-dione |
| SMILES | Nc1cccc2c1C(=O)N(C(=O)[C@@H]1CCCN1C(=O)c1cccs1)C2=O |
| InChI | InChI=1S/C18H15N3O4S/c19-11-5-1-4-10-14(11)18(25)21(15(10)22)16(23)12-6-2-8-20(12)17(24)13-7-3-9-26-13/h1,3-5,7,9,12H,2,6,8,19H2/t12-/m0/s1 |
| InChIKey | DTQDTHVRQZFYKL-LBPRGKRZSA-N |
| XLogP | 1.76 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|