C11H14N2O4S2 — CID 94188023
(2R)-N-methylsulfonyl-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 94188023) has the molecular formula C11H14N2O4S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (2R)-N-methylsulfonyl-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-methylsulfonyl-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 94188023 |
| Molecular Formula | C11H14N2O4S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | (2R)-N-methylsulfonyl-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)[C@H]1CCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C11H14N2O4S2/c1-19(16,17)12-10(14)8-4-2-6-13(8)11(15)9-5-3-7-18-9/h3,5,7-8H,2,4,6H2,1H3,(H,12,14)/t8-/m1/s1 |
| InChIKey | UPQAJYMELGPPDD-MRVPVSSYSA-N |
| XLogP | 0.43 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |