C18H19N3O5S2 — CID 39049673
(2S)-N'-(4-methylsulfonylbenzoyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbohydrazide (PubChem CID 39049673) has the molecular formula C18H19N3O5S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is (2S)-N'-(4-methylsulfonylbenzoyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbohydrazide.
| Compound Name | (2S)-N'-(4-methylsulfonylbenzoyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 39049673 |
| Molecular Formula | C18H19N3O5S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | (2S)-N'-(4-methylsulfonylbenzoyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbohydrazide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NNC(=O)[C@@H]2CCCN2C(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H19N3O5S2/c1-28(25,26)13-8-6-12(7-9-13)16(22)19-20-17(23)14-4-2-10-21(14)18(24)15-5-3-11-27-15/h3,5-9,11,14H,2,4,10H2,1H3,(H,19,22)(H,20,23)/t14-/m0/s1 |
| InChIKey | BJLSWKUIXNVXAY-AWEZNQCLSA-N |
| XLogP | 1.22 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|