C21H20N4O5S3 — CID 25340618
N-[4-[[[(2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbonyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 25340618) has the molecular formula C21H20N4O5S3 and a molecular weight of 504.62 g/mol. Its IUPAC name is N-[4-[[[(2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbonyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[[[(2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbonyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 25340618 |
| Molecular Formula | C21H20N4O5S3 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | N-[4-[[[(2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbonyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(NNC(=O)[C@@H]1CCCN1C(=O)c1cccs1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C21H20N4O5S3/c26-19(14-7-9-15(10-8-14)24-33(29,30)18-6-3-13-32-18)22-23-20(27)16-4-1-11-25(16)21(28)17-5-2-12-31-17/h2-3,5-10,12-13,16,24H,1,4,11H2,(H,22,26)(H,23,27)/t16-/m0/s1 |
| InChIKey | YFNDFHJOMSXPEA-INIZCTEOSA-N |
| XLogP | 2.68 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|