C19H23N3O3S2 — CID 41269183
N-(1-cyclopropylpiperidin-4-yl)-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 41269183) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is N-(1-cyclopropylpiperidin-4-yl)-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-(1-cyclopropylpiperidin-4-yl)-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 41269183 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-(1-cyclopropylpiperidin-4-yl)-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NC1CCN(C2CC2)CC1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H23N3O3S2/c23-19(20-15-9-11-22(12-10-15)17-7-8-17)14-3-5-16(6-4-14)21-27(24,25)18-2-1-13-26-18/h1-6,13,15,17,21H,7-12H2,(H,20,23) |
| InChIKey | SINUODOSMQJWBU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |