C22H29N3O3S2 — CID 56569161
N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide (PubChem CID 56569161) has the molecular formula C22H29N3O3S2 and a molecular weight of 447.63 g/mol. Its IUPAC name is N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide.
| Compound Name | N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 56569161 |
| Molecular Formula | C22H29N3O3S2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)Cc2ccc(NS(=O)(=O)c3cccs3)cc2)CC1 |
| InChI | InChI=1S/C22H29N3O3S2/c1-17(2)9-12-25-13-10-19(11-14-25)23-21(26)16-18-5-7-20(8-6-18)24-30(27,28)22-4-3-15-29-22/h3-9,15,19,24H,10-14,16H2,1-2H3,(H,23,26) |
| InChIKey | XKDKLQRCOSICED-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|