C22H26N4O5S2 — CID 55814844
N-[4-[2-oxo-2-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazin-1-yl]ethyl]phenyl]thiophene-2-sulfonamide (PubChem CID 55814844) has the molecular formula C22H26N4O5S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is N-[4-[2-oxo-2-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazin-1-yl]ethyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[2-oxo-2-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazin-1-yl]ethyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55814844 |
| Molecular Formula | C22H26N4O5S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | N-[4-[2-oxo-2-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazin-1-yl]ethyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(Cc1ccc(NS(=O)(=O)c2cccs2)cc1)N1CCN(C(=O)C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C22H26N4O5S2/c27-19(24-11-13-26(14-12-24)22(29)21(28)25-9-1-2-10-25)16-17-5-7-18(8-6-17)23-33(30,31)20-4-3-15-32-20/h3-8,15,23H,1-2,9-14,16H2 |
| InChIKey | XFIJXJSMUOXZBC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|