C19H22N2O6S2 — CID 25045245
[2-(azepan-1-yl)-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 25045245) has the molecular formula C19H22N2O6S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 25045245 |
| Molecular Formula | C19H22N2O6S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(OCC(=O)N1CCCCCC1)c1cc(NS(=O)(=O)c2cccs2)ccc1O |
| InChI | InChI=1S/C19H22N2O6S2/c22-16-8-7-14(20-29(25,26)18-6-5-11-28-18)12-15(16)19(24)27-13-17(23)21-9-3-1-2-4-10-21/h5-8,11-12,20,22H,1-4,9-10,13H2 |
| InChIKey | IJGIVQAWMPZMNT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|