C19H15BrN2O6S2 — CID 25035059
[2-(4-bromoanilino)-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 25035059) has the molecular formula C19H15BrN2O6S2 and a molecular weight of 511.38 g/mol. Its IUPAC name is [2-(4-bromoanilino)-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-(4-bromoanilino)-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 25035059 |
| Molecular Formula | C19H15BrN2O6S2 |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 509.96 |
| IUPAC Name | [2-(4-bromoanilino)-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(COC(=O)c1cc(NS(=O)(=O)c2cccs2)ccc1O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H15BrN2O6S2/c20-12-3-5-13(6-4-12)21-17(24)11-28-19(25)15-10-14(7-8-16(15)23)22-30(26,27)18-2-1-9-29-18/h1-10,22-23H,11H2,(H,21,24) |
| InChIKey | NYBMPOBNJFLKNH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|