C23H24ClN3O8S3 — CID 4157813
[2-[2-chloro-5-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 4157813) has the molecular formula C23H24ClN3O8S3 and a molecular weight of 602.11 g/mol. Its IUPAC name is [2-[2-chloro-5-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-[2-chloro-5-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 4157813 |
| Molecular Formula | C23H24ClN3O8S3 |
| Molecular Weight | 602.11 g/mol |
| Exact Mass | 601.04 |
| IUPAC Name | [2-[2-chloro-5-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-hydroxy-5-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)COC(=O)c2cc(NS(=O)(=O)c3cccs3)ccc2O)c1 |
| InChI | InChI=1S/C23H24ClN3O8S3/c1-3-27(4-2)38(33,34)16-8-9-18(24)19(13-16)25-21(29)14-35-23(30)17-12-15(7-10-20(17)28)26-37(31,32)22-6-5-11-36-22/h5-13,26,28H,3-4,14H2,1-2H3,(H,25,29) |
| InChIKey | GMBSTMZINDPQCC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.11 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|