C19H14ClFN2O5S2 — CID 16539393
[2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 16539393) has the molecular formula C19H14ClFN2O5S2 and a molecular weight of 468.92 g/mol. Its IUPAC name is [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 16539393 |
| Molecular Formula | C19H14ClFN2O5S2 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1NS(=O)(=O)c1cccs1)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H14ClFN2O5S2/c20-14-10-12(7-8-15(14)21)22-17(24)11-28-19(25)13-4-1-2-5-16(13)23-30(26,27)18-6-3-9-29-18/h1-10,23H,11H2,(H,22,24) |
| InChIKey | IJCJXGKVLDMERK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |